C14H20F3N5O — CID 147561163
(9aR)-1-oxo-2-[4-(trifluoromethyl)piperidin-2-yl]-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carbonitrile (PubChem CID 147561163) has the molecular formula C14H20F3N5O and a molecular weight of 331.34 g/mol. Its IUPAC name is (9aR)-1-oxo-2-[4-(trifluoromethyl)piperidin-2-yl]-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carbonitrile.
| Compound Name | (9aR)-1-oxo-2-[4-(trifluoromethyl)piperidin-2-yl]-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carbonitrile |
|---|---|
| PubChem CID | 147561163 |
| Molecular Formula | C14H20F3N5O |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (9aR)-1-oxo-2-[4-(trifluoromethyl)piperidin-2-yl]-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carbonitrile |
| SMILES | N#CN1CCN2CCN(C3CC(C(F)(F)F)CCN3)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C14H20F3N5O/c15-14(16,17)10-1-2-19-12(7-10)22-6-5-21-4-3-20(9-18)8-11(21)13(22)23/h10-12,19H,1-8H2/t10?,11-,12?/m1/s1 |
| InChIKey | DDQGVCYNMLVICA-MOENNCHZSA-N |
| XLogP | 0.18 |
| TPSA | 62.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|