C17H19NO2 — CID 147572961
8,8-dimethyl-3,7-dioxo-5,6,8a,9,10,10a-hexahydro-4bH-phenanthrene-2-carbonitrile (PubChem CID 147572961) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 8,8-dimethyl-3,7-dioxo-5,6,8a,9,10,10a-hexahydro-4bH-phenanthrene-2-carbonitrile.
| Compound Name | 8,8-dimethyl-3,7-dioxo-5,6,8a,9,10,10a-hexahydro-4bH-phenanthrene-2-carbonitrile |
|---|---|
| PubChem CID | 147572961 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 8,8-dimethyl-3,7-dioxo-5,6,8a,9,10,10a-hexahydro-4bH-phenanthrene-2-carbonitrile |
| SMILES | CC1(C)C(=O)CCC2C3=CC(=O)C(C#N)=CC3CCC21 |
| InChI | InChI=1S/C17H19NO2/c1-17(2)14-5-3-10-7-11(9-18)15(19)8-13(10)12(14)4-6-16(17)20/h7-8,10,12,14H,3-6H2,1-2H3 |
| InChIKey | FUXCUVZBSMZKHJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |