C21H27NO2 — CID 123593434
4,4,10-trimethyl-3,17-dioxo-6,7,8,9,11,12,13,14,15,16-decahydro-5H-cyclopenta[a]phenanthrene-2-carbonitrile (PubChem CID 123593434) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 4,4,10-trimethyl-3,17-dioxo-6,7,8,9,11,12,13,14,15,16-decahydro-5H-cyclopenta[a]phenanthrene-2-carbonitrile.
| Compound Name | 4,4,10-trimethyl-3,17-dioxo-6,7,8,9,11,12,13,14,15,16-decahydro-5H-cyclopenta[a]phenanthrene-2-carbonitrile |
|---|---|
| PubChem CID | 123593434 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 4,4,10-trimethyl-3,17-dioxo-6,7,8,9,11,12,13,14,15,16-decahydro-5H-cyclopenta[a]phenanthrene-2-carbonitrile |
| SMILES | CC1(C)C(=O)C(C#N)=CC2(C)C3CCC4C(=O)CCC4C3CCC12 |
| InChI | InChI=1S/C21H27NO2/c1-20(2)18-9-6-14-13-5-8-17(23)15(13)4-7-16(14)21(18,3)10-12(11-22)19(20)24/h10,13-16,18H,4-9H2,1-3H3 |
| InChIKey | FZLSUHAHUOZNTD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |