C29H41NO3 — CID 144586862
(6bS)-6a-hydroxy-4,4,6a,6b,8a,14b-hexamethyl-3,13-dioxo-4a,5,6,7,8,9,10,11,12,12a,14,14a-dodecahydropicene-2-carbonitrile (PubChem CID 144586862) has the molecular formula C29H41NO3 and a molecular weight of 451.65 g/mol. Its IUPAC name is (6bS)-6a-hydroxy-4,4,6a,6b,8a,14b-hexamethyl-3,13-dioxo-4a,5,6,7,8,9,10,11,12,12a,14,14a-dodecahydropicene-2-carbonitrile.
| Compound Name | (6bS)-6a-hydroxy-4,4,6a,6b,8a,14b-hexamethyl-3,13-dioxo-4a,5,6,7,8,9,10,11,12,12a,14,14a-dodecahydropicene-2-carbonitrile |
|---|---|
| PubChem CID | 144586862 |
| Molecular Formula | C29H41NO3 |
| Molecular Weight | 451.65 g/mol |
| Exact Mass | 451.31 |
| IUPAC Name | (6bS)-6a-hydroxy-4,4,6a,6b,8a,14b-hexamethyl-3,13-dioxo-4a,5,6,7,8,9,10,11,12,12a,14,14a-dodecahydropicene-2-carbonitrile |
| SMILES | CC12CCCCC1C1(O)C(=O)CC3C4(C)C=C(C#N)C(=O)C(C)(C)C4CCC3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C29H41NO3/c1-24(2)19-10-12-27(5)21(26(19,4)16-18(17-30)23(24)32)15-22(31)29(33)20-9-7-8-11-25(20,3)13-14-28(27,29)6/h16,19-21,33H,7-15H2,1-6H3/t19?,20?,21?,25?,26?,27?,28-,29?/m0/s1 |
| InChIKey | WKIKPRZTMQVMDB-ODUGSFGESA-N |
| XLogP | 5.78 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.65 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |