C10H25N3O4SSi — CID 147578496
4-[hydroxy(2-trimethylsilylethoxy)methyl]piperazine-1-sulfonamide (PubChem CID 147578496) has the molecular formula C10H25N3O4SSi and a molecular weight of 311.48 g/mol. Its IUPAC name is 4-[hydroxy(2-trimethylsilylethoxy)methyl]piperazine-1-sulfonamide.
| Compound Name | 4-[hydroxy(2-trimethylsilylethoxy)methyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 147578496 |
| Molecular Formula | C10H25N3O4SSi |
| Molecular Weight | 311.48 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 4-[hydroxy(2-trimethylsilylethoxy)methyl]piperazine-1-sulfonamide |
| SMILES | C[Si](C)(C)CCOC(O)N1CCN(S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C10H25N3O4SSi/c1-19(2,3)9-8-17-10(14)12-4-6-13(7-5-12)18(11,15)16/h10,14H,4-9H2,1-3H3,(H2,11,15,16) |
| InChIKey | FVYCCWSFQRCRGM-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.48 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|