C20H28O4 — CID 147592012
5,6-dihydroxy-7-(hydroxymethyl)-3,4,11,11-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one (PubChem CID 147592012) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is 5,6-dihydroxy-7-(hydroxymethyl)-3,4,11,11-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one.
| Compound Name | 5,6-dihydroxy-7-(hydroxymethyl)-3,4,11,11-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one |
|---|---|
| PubChem CID | 147592012 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 5,6-dihydroxy-7-(hydroxymethyl)-3,4,11,11-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one |
| SMILES | CC1=CC23CCC4C(C(C=C(CO)C(O)C2(O)C1C)C3=O)C4(C)C |
| InChI | InChI=1S/C20H28O4/c1-10-8-19-6-5-14-15(18(14,3)4)13(17(19)23)7-12(9-21)16(22)20(19,24)11(10)2/h7-8,11,13-16,21-22,24H,5-6,9H2,1-4H3 |
| InChIKey | FYMAASAJYPGGDM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|