C19H26O5 — CID 155052743
(1S,4S,5R,6R,10R,12R)-4,5,6-trihydroxy-7-(hydroxymethyl)-3,11,11-trimethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one (PubChem CID 155052743) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is (1S,4S,5R,6R,10R,12R)-4,5,6-trihydroxy-7-(hydroxymethyl)-3,11,11-trimethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one.
| Compound Name | (1S,4S,5R,6R,10R,12R)-4,5,6-trihydroxy-7-(hydroxymethyl)-3,11,11-trimethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one |
|---|---|
| PubChem CID | 155052743 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (1S,4S,5R,6R,10R,12R)-4,5,6-trihydroxy-7-(hydroxymethyl)-3,11,11-trimethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one |
| SMILES | CC1=C[C@@]23CC[C@@H]4[C@H](C(C=C(CO)[C@@H](O)[C@]2(O)[C@H]1O)C3=O)C4(C)C |
| InChI | InChI=1S/C19H26O5/c1-9-7-18-5-4-12-13(17(12,2)3)11(16(18)23)6-10(8-20)15(22)19(18,24)14(9)21/h6-7,11-15,20-22,24H,4-5,8H2,1-3H3/t11?,12-,13+,14+,15-,18-,19-/m1/s1 |
| InChIKey | MOMPZHNYHWNHJG-YCWRECGSSA-N |
| XLogP | 0.57 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|