C21H27FN5O3S- — CID 147617963
CID 147617963 (PubChem CID 147617963) has the molecular formula C21H27FN5O3S- and a molecular weight of 448.54 g/mol.
| Compound Name | CID 147617963 |
|---|---|
| PubChem CID | 147617963 |
| Molecular Formula | C21H27FN5O3S- |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | — |
| SMILES | CN(C)C1CN=C(C(=CN)/[S-](=O)=N/C(=O)Nc2c3c(c(F)c4c2CCC4)CCC3)OC1 |
| InChI | InChI=1S/C21H27FN5O3S/c1-27(2)12-10-24-20(30-11-12)17(9-23)31(29)26-21(28)25-19-15-7-3-5-13(15)18(22)14-6-4-8-16(14)19/h9,12H,3-8,10-11,23H2,1-2H3,(H,25,28)/q-1 |
| InChIKey | ISIVCKUXTCGDPW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 109.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|