C19H22O3S — CID 14764856
2-[4-ethyl-6-(4-methylphenyl)sulfonylhexa-4,5-dienyl]furan (PubChem CID 14764856) has the molecular formula C19H22O3S and a molecular weight of 330.45 g/mol. Its IUPAC name is 2-[4-ethyl-6-(4-methylphenyl)sulfonylhexa-4,5-dienyl]furan.
| Compound Name | 2-[4-ethyl-6-(4-methylphenyl)sulfonylhexa-4,5-dienyl]furan |
|---|---|
| PubChem CID | 14764856 |
| Molecular Formula | C19H22O3S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 2-[4-ethyl-6-(4-methylphenyl)sulfonylhexa-4,5-dienyl]furan |
| SMILES | CCC(=C=CS(=O)(=O)c1ccc(C)cc1)CCCc1ccco1 |
| InChI | InChI=1S/C19H22O3S/c1-3-17(6-4-7-18-8-5-14-22-18)13-15-23(20,21)19-11-9-16(2)10-12-19/h5,8-12,14-15H,3-4,6-7H2,1-2H3 |
| InChIKey | MZFJYZWCWPVYTE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |