About 2-[4-ethyl-6-(4-methylphenyl)sulfonylhexa-4,5-dienyl]furan
2-[4-ethyl-6-(4-methylphenyl)sulfonylhexa-4,5-dienyl]furan (PubChem CID 14764856) has the molecular formula C19H22O3S
and a molecular weight of 330.45 g/mol. Its IUPAC name is 2-[4-ethyl-6-(4-methylphenyl)sulfonylhexa-4,5-dienyl]furan.
Molecular Properties
| Compound Name | 2-[4-ethyl-6-(4-methylphenyl)sulfonylhexa-4,5-dienyl]furan |
| PubChem CID | 14764856 |
| Molecular Formula | C19H22O3S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 2-[4-ethyl-6-(4-methylphenyl)sulfonylhexa-4,5-dienyl]furan |
| SMILES | CCC(=C=CS(=O)(=O)c1ccc(C)cc1)CCCc1ccco1 |
| InChI | InChI=1S/C19H22O3S/c1-3-17(6-4-7-18-8-5-14-22-18)13-15-23(20,21)19-11-9-16(2)10-12-19/h5,8-12,14-15H,3-4,6-7H2,1-2H3 |
| InChIKey | MZFJYZWCWPVYTE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-ethyl-6-(4-methylphenyl)sulfonylhexa-4,5-dienyl]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-ethyl-6-(4-methylphenyl)sulfonylhexa-4,5-dienyl]furan?
The IUPAC name of 2-[4-ethyl-6-(4-methylphenyl)sulfonylhexa-4,5-dienyl]furan (CID 14764856) is 2-[4-ethyl-6-(4-methylphenyl)sulfonylhexa-4,5-dienyl]furan.
What is the SMILES notation for 2-[4-ethyl-6-(4-methylphenyl)sulfonylhexa-4,5-dienyl]furan?
The canonical SMILES for 2-[4-ethyl-6-(4-methylphenyl)sulfonylhexa-4,5-dienyl]furan is CCC(=C=CS(=O)(=O)c1ccc(C)cc1)CCCc1ccco1.
What is the InChIKey of 2-[4-ethyl-6-(4-methylphenyl)sulfonylhexa-4,5-dienyl]furan?
The InChIKey is MZFJYZWCWPVYTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O3S/c1-3-17(6-4-7-18-8-5-14-22-18)13-15-23(20,21)19-11-9-16(2)10-12-19/h5,8-12,14-15H,3-4,6-7H2,1-2H3.
What are the key properties of 2-[4-ethyl-6-(4-methylphenyl)sulfonylhexa-4,5-dienyl]furan?
2-[4-ethyl-6-(4-methylphenyl)sulfonylhexa-4,5-dienyl]furan has a molecular weight of 330.45 g/mol, XLogP of 4.83, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-ethyl-6-(4-methylphenyl)sulfonylhexa-4,5-dienyl]furan is sourced from PubChem (CID 14764856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).