C16H20O4S — CID 21301478
2-(furan-2-ylmethyl)butyl 4-methylbenzenesulfonate (PubChem CID 21301478) has the molecular formula C16H20O4S and a molecular weight of 308.40 g/mol. Its IUPAC name is 2-(furan-2-ylmethyl)butyl 4-methylbenzenesulfonate.
| Compound Name | 2-(furan-2-ylmethyl)butyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 21301478 |
| Molecular Formula | C16H20O4S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 2-(furan-2-ylmethyl)butyl 4-methylbenzenesulfonate |
| SMILES | CCC(COS(=O)(=O)c1ccc(C)cc1)Cc1ccco1 |
| InChI | InChI=1S/C16H20O4S/c1-3-14(11-15-5-4-10-19-15)12-20-21(17,18)16-8-6-13(2)7-9-16/h4-10,14H,3,11-12H2,1-2H3 |
| InChIKey | VQSGMIWPEUMPPG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|