C20H18O7S — CID 102280687
[3-[3-(furan-2-yl)propanoyl]-6-methyl-2-oxopyran-4-yl] 4-methylbenzenesulfonate (PubChem CID 102280687) has the molecular formula C20H18O7S and a molecular weight of 402.42 g/mol. Its IUPAC name is [3-[3-(furan-2-yl)propanoyl]-6-methyl-2-oxopyran-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [3-[3-(furan-2-yl)propanoyl]-6-methyl-2-oxopyran-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 102280687 |
| Molecular Formula | C20H18O7S |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | [3-[3-(furan-2-yl)propanoyl]-6-methyl-2-oxopyran-4-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cc(C)oc(=O)c2C(=O)CCc2ccco2)cc1 |
| InChI | InChI=1S/C20H18O7S/c1-13-5-8-16(9-6-13)28(23,24)27-18-12-14(2)26-20(22)19(18)17(21)10-7-15-4-3-11-25-15/h3-6,8-9,11-12H,7,10H2,1-2H3 |
| InChIKey | UVEDHAVXTUAVGX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 103.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|