C30H36O5 — CID 147656237
5-[(E)-2-[(7R,8aR,10aR)-4,7-dihydroxy-8,8,10a-trimethyl-6,7,8a,9-tetrahydro-5H-xanthen-2-yl]ethenyl]-3-hydroxy-2-(3-methylbut-2-enyl)benzaldehyde (PubChem CID 147656237) has the molecular formula C30H36O5 and a molecular weight of 476.61 g/mol. Its IUPAC name is 5-[(E)-2-[(7R,8aR,10aR)-4,7-dihydroxy-8,8,10a-trimethyl-6,7,8a,9-tetrahydro-5H-xanthen-2-yl]ethenyl]-3-hydroxy-2-(3-methylbut-2-enyl)benzaldehyde.
| Compound Name | 5-[(E)-2-[(7R,8aR,10aR)-4,7-dihydroxy-8,8,10a-trimethyl-6,7,8a,9-tetrahydro-5H-xanthen-2-yl]ethenyl]-3-hydroxy-2-(3-methylbut-2-enyl)benzaldehyde |
|---|---|
| PubChem CID | 147656237 |
| Molecular Formula | C30H36O5 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | 5-[(E)-2-[(7R,8aR,10aR)-4,7-dihydroxy-8,8,10a-trimethyl-6,7,8a,9-tetrahydro-5H-xanthen-2-yl]ethenyl]-3-hydroxy-2-(3-methylbut-2-enyl)benzaldehyde |
| SMILES | CC(C)=CCc1c(O)cc(/C=C/c2cc(O)c3c(c2)C[C@@H]2C(C)(C)[C@H](O)CC[C@@]2(C)O3)cc1C=O |
| InChI | InChI=1S/C30H36O5/c1-18(2)6-9-23-22(17-31)13-20(14-24(23)32)8-7-19-12-21-16-26-29(3,4)27(34)10-11-30(26,5)35-28(21)25(33)15-19/h6-8,12-15,17,26-27,32-34H,9-11,16H2,1-5H3/b8-7+/t26-,27-,30-/m1/s1 |
| InChIKey | GKLMGTGMSNLKQF-IHXPRAQDSA-N |
| XLogP | 6.08 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|