C19H26O3 — CID 155451372
(2R,4aR,9aR)-1,1,4a-trimethyl-7-[(E)-prop-1-enyl]-3,4,9,9a-tetrahydro-2H-xanthene-2,5-diol (PubChem CID 155451372) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (2R,4aR,9aR)-1,1,4a-trimethyl-7-[(E)-prop-1-enyl]-3,4,9,9a-tetrahydro-2H-xanthene-2,5-diol.
| Compound Name | (2R,4aR,9aR)-1,1,4a-trimethyl-7-[(E)-prop-1-enyl]-3,4,9,9a-tetrahydro-2H-xanthene-2,5-diol |
|---|---|
| PubChem CID | 155451372 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (2R,4aR,9aR)-1,1,4a-trimethyl-7-[(E)-prop-1-enyl]-3,4,9,9a-tetrahydro-2H-xanthene-2,5-diol |
| SMILES | C/C=C/c1cc(O)c2c(c1)C[C@@H]1C(C)(C)[C@H](O)CC[C@@]1(C)O2 |
| InChI | InChI=1S/C19H26O3/c1-5-6-12-9-13-11-15-18(2,3)16(21)7-8-19(15,4)22-17(13)14(20)10-12/h5-6,9-10,15-16,20-21H,7-8,11H2,1-4H3/b6-5+/t15-,16-,19-/m1/s1 |
| InChIKey | ITFURDVLVFZHBB-AUKPOOJJSA-N |
| XLogP | 3.92 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |