C38H49NO4 — CID 90670094
(2R,4aR,9aR)-7-[(E)-2-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methoxy-1H-indol-6-yl]ethenyl]-5-methoxy-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-xanthen-2-ol (PubChem CID 90670094) has the molecular formula C38H49NO4 and a molecular weight of 583.81 g/mol. Its IUPAC name is (2R,4aR,9aR)-7-[(E)-2-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methoxy-1H-indol-6-yl]ethenyl]-5-methoxy-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-xanthen-2-ol.
| Compound Name | (2R,4aR,9aR)-7-[(E)-2-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methoxy-1H-indol-6-yl]ethenyl]-5-methoxy-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-xanthen-2-ol |
|---|---|
| PubChem CID | 90670094 |
| Molecular Formula | C38H49NO4 |
| Molecular Weight | 583.81 g/mol |
| Exact Mass | 583.37 |
| IUPAC Name | (2R,4aR,9aR)-7-[(E)-2-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methoxy-1H-indol-6-yl]ethenyl]-5-methoxy-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-xanthen-2-ol |
| SMILES | COc1cc(/C=C/c2cc(OC)c3c(C/C=C(\C)CCC=C(C)C)c[nH]c3c2)cc2c1O[C@]1(C)CC[C@@H](O)C(C)(C)[C@H]1C2 |
| InChI | InChI=1S/C38H49NO4/c1-24(2)10-9-11-25(3)12-15-28-23-39-30-19-27(20-31(41-7)35(28)30)14-13-26-18-29-22-33-37(4,5)34(40)16-17-38(33,6)43-36(29)32(21-26)42-8/h10,12-14,18-21,23,33-34,39-40H,9,11,15-17,22H2,1-8H3/b14-13+,25-12+/t33-,34-,38-/m1/s1 |
| InChIKey | JUJYUGPJQPZCSL-VQPZTTCPSA-N |
| XLogP | 9.08 |
| TPSA | 63.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.81 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|