C33H42O6 — CID 118629587
(4aR,9aR)-7-[(E)-2-[4-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5-dihydroxyphenyl]ethenyl]-5-methoxy-4a-methyl-1,2,3,4,9,9a-hexahydroxanthene-2,3-diol (PubChem CID 118629587) has the molecular formula C33H42O6 and a molecular weight of 534.69 g/mol. Its IUPAC name is (4aR,9aR)-7-[(E)-2-[4-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5-dihydroxyphenyl]ethenyl]-5-methoxy-4a-methyl-1,2,3,4,9,9a-hexahydroxanthene-2,3-diol.
| Compound Name | (4aR,9aR)-7-[(E)-2-[4-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5-dihydroxyphenyl]ethenyl]-5-methoxy-4a-methyl-1,2,3,4,9,9a-hexahydroxanthene-2,3-diol |
|---|---|
| PubChem CID | 118629587 |
| Molecular Formula | C33H42O6 |
| Molecular Weight | 534.69 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | (4aR,9aR)-7-[(E)-2-[4-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5-dihydroxyphenyl]ethenyl]-5-methoxy-4a-methyl-1,2,3,4,9,9a-hexahydroxanthene-2,3-diol |
| SMILES | COc1cc(/C=C/c2cc(O)c(C/C=C(\C)CCC=C(C)C)c(O)c2)cc2c1O[C@]1(C)CC(O)C(O)C[C@H]1C2 |
| InChI | InChI=1S/C33H42O6/c1-20(2)7-6-8-21(3)9-12-26-27(34)14-23(15-28(26)35)11-10-22-13-24-17-25-18-29(36)30(37)19-33(25,4)39-32(24)31(16-22)38-5/h7,9-11,13-16,25,29-30,34-37H,6,8,12,17-19H2,1-5H3/b11-10+,21-9+/t25-,29?,30?,33-/m1/s1 |
| InChIKey | JEMBSEODWDINDK-TUUYNPOASA-N |
| XLogP | 6.34 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.69 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|