C34H37NO8 — CID 44601440
(2S,3R,4aR,9aR)-7-[(E)-2-[3-hydroxy-5-methoxy-4-[(E)-2-(4-nitrophenyl)ethenyl]phenyl]ethenyl]-5-methoxy-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-xanthene-2,3-diol (PubChem CID 44601440) has the molecular formula C34H37NO8 and a molecular weight of 587.67 g/mol. Its IUPAC name is (2S,3R,4aR,9aR)-7-[(E)-2-[3-hydroxy-5-methoxy-4-[(E)-2-(4-nitrophenyl)ethenyl]phenyl]ethenyl]-5-methoxy-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-xanthene-2,3-diol.
| Compound Name | (2S,3R,4aR,9aR)-7-[(E)-2-[3-hydroxy-5-methoxy-4-[(E)-2-(4-nitrophenyl)ethenyl]phenyl]ethenyl]-5-methoxy-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-xanthene-2,3-diol |
|---|---|
| PubChem CID | 44601440 |
| Molecular Formula | C34H37NO8 |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | (2S,3R,4aR,9aR)-7-[(E)-2-[3-hydroxy-5-methoxy-4-[(E)-2-(4-nitrophenyl)ethenyl]phenyl]ethenyl]-5-methoxy-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-xanthene-2,3-diol |
| SMILES | COc1cc(/C=C/c2cc3c(c(OC)c2)O[C@]2(C)C[C@@H](O)[C@@H](O)C(C)(C)[C@H]2C3)cc(O)c1/C=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C34H37NO8/c1-33(2)30-18-23-14-21(17-29(42-5)31(23)43-34(30,3)19-27(37)32(33)38)6-7-22-15-26(36)25(28(16-22)41-4)13-10-20-8-11-24(12-9-20)35(39)40/h6-17,27,30,32,36-38H,18-19H2,1-5H3/b7-6+,13-10+/t27-,30-,32-,34-/m1/s1 |
| InChIKey | KOZICTSXHVVSNR-RHPLSQAISA-N |
| XLogP | 6.12 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|