C36H44O6 — CID 143919165
2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-5-[(E)-2-(4-methoxy-8,8-dimethyl-5,6,7,8a,9,10a-hexahydroxanthen-2-yl)ethenyl]benzene-1,3-diol;ethane (PubChem CID 143919165) has the molecular formula C36H44O6 and a molecular weight of 572.74 g/mol. Its IUPAC name is 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-5-[(E)-2-(4-methoxy-8,8-dimethyl-5,6,7,8a,9,10a-hexahydroxanthen-2-yl)ethenyl]benzene-1,3-diol;ethane.
| Compound Name | 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-5-[(E)-2-(4-methoxy-8,8-dimethyl-5,6,7,8a,9,10a-hexahydroxanthen-2-yl)ethenyl]benzene-1,3-diol;ethane |
|---|---|
| PubChem CID | 143919165 |
| Molecular Formula | C36H44O6 |
| Molecular Weight | 572.74 g/mol |
| Exact Mass | 572.31 |
| IUPAC Name | 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-5-[(E)-2-(4-methoxy-8,8-dimethyl-5,6,7,8a,9,10a-hexahydroxanthen-2-yl)ethenyl]benzene-1,3-diol;ethane |
| SMILES | CC.COc1ccc(/C=C/c2c(O)cc(/C=C/c3cc4c(c(OC)c3)OC3CCCC(C)(C)C3C4)cc2O)cc1OC |
| InChI | InChI=1S/C34H38O6.C2H6/c1-34(2)14-6-7-29-26(34)20-24-15-22(19-32(39-5)33(24)40-29)8-9-23-16-27(35)25(28(36)17-23)12-10-21-11-13-30(37-3)31(18-21)38-4;1-2/h8-13,15-19,26,29,35-36H,6-7,14,20H2,1-5H3;1-2H3/b9-8+,12-10+; |
| InChIKey | MPGCGOZDQMCYLM-AJXSQWBMSA-N |
| XLogP | 8.62 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.74 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|