C31H37NO4 — CID 131969929
6-[(E)-2-[(7R,8aR)-7-hydroxy-4-methoxy-8,8-dimethyl-5,6,7,8a,9,10a-hexahydroxanthen-2-yl]ethenyl]-2-(3-methylbut-2-enyl)-1H-indol-4-ol (PubChem CID 131969929) has the molecular formula C31H37NO4 and a molecular weight of 487.64 g/mol. Its IUPAC name is 6-[(E)-2-[(7R,8aR)-7-hydroxy-4-methoxy-8,8-dimethyl-5,6,7,8a,9,10a-hexahydroxanthen-2-yl]ethenyl]-2-(3-methylbut-2-enyl)-1H-indol-4-ol.
| Compound Name | 6-[(E)-2-[(7R,8aR)-7-hydroxy-4-methoxy-8,8-dimethyl-5,6,7,8a,9,10a-hexahydroxanthen-2-yl]ethenyl]-2-(3-methylbut-2-enyl)-1H-indol-4-ol |
|---|---|
| PubChem CID | 131969929 |
| Molecular Formula | C31H37NO4 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | 6-[(E)-2-[(7R,8aR)-7-hydroxy-4-methoxy-8,8-dimethyl-5,6,7,8a,9,10a-hexahydroxanthen-2-yl]ethenyl]-2-(3-methylbut-2-enyl)-1H-indol-4-ol |
| SMILES | COc1cc(/C=C/c2cc(O)c3cc(CC=C(C)C)[nH]c3c2)cc2c1OC1CC[C@@H](O)C(C)(C)[C@H]1C2 |
| InChI | InChI=1S/C31H37NO4/c1-18(2)6-9-22-17-23-25(32-22)13-20(14-26(23)33)8-7-19-12-21-16-24-27(10-11-29(34)31(24,3)4)36-30(21)28(15-19)35-5/h6-8,12-15,17,24,27,29,32-34H,9-11,16H2,1-5H3/b8-7+/t24-,27?,29+/m0/s1 |
| InChIKey | XXDKLKJZCUGDIM-YZPKGVJCSA-N |
| XLogP | 6.66 |
| TPSA | 74.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|