C35H45BrO4 — CID 57397153
(2R,4aR,9aR)-5-bromo-7-[(E)-2-[4-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-hydroxy-5-methoxyphenyl]ethenyl]-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-xanthen-2-ol (PubChem CID 57397153) has the molecular formula C35H45BrO4 and a molecular weight of 609.65 g/mol. Its IUPAC name is (2R,4aR,9aR)-5-bromo-7-[(E)-2-[4-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-hydroxy-5-methoxyphenyl]ethenyl]-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-xanthen-2-ol.
| Compound Name | (2R,4aR,9aR)-5-bromo-7-[(E)-2-[4-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-hydroxy-5-methoxyphenyl]ethenyl]-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-xanthen-2-ol |
|---|---|
| PubChem CID | 57397153 |
| Molecular Formula | C35H45BrO4 |
| Molecular Weight | 609.65 g/mol |
| Exact Mass | 608.25 |
| IUPAC Name | (2R,4aR,9aR)-5-bromo-7-[(E)-2-[4-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-hydroxy-5-methoxyphenyl]ethenyl]-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-xanthen-2-ol |
| SMILES | COc1cc(/C=C/c2cc(Br)c3c(c2)C[C@@H]2C(C)(C)[C@H](O)CC[C@@]2(C)O3)cc(O)c1C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C35H45BrO4/c1-22(2)9-8-10-23(3)11-14-27-29(37)19-25(20-30(27)39-7)13-12-24-17-26-21-31-34(4,5)32(38)15-16-35(31,6)40-33(26)28(36)18-24/h9,11-13,17-20,31-32,37-38H,8,10,14-16,21H2,1-7H3/b13-12+,23-11+/t31-,32-,35-/m1/s1 |
| InChIKey | GWXOZNLHECUCEI-KFNWDQBUSA-N |
| XLogP | 9.06 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.65 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|