C19H24ClNO4S — CID 147729484
1-(4-chloro-2-hydroxy-3-pyrrolidin-1-ylsulfonylphenyl)-3-(2-methylcyclopent-2-en-1-yl)propan-2-one (PubChem CID 147729484) has the molecular formula C19H24ClNO4S and a molecular weight of 397.92 g/mol. Its IUPAC name is 1-(4-chloro-2-hydroxy-3-pyrrolidin-1-ylsulfonylphenyl)-3-(2-methylcyclopent-2-en-1-yl)propan-2-one.
| Compound Name | 1-(4-chloro-2-hydroxy-3-pyrrolidin-1-ylsulfonylphenyl)-3-(2-methylcyclopent-2-en-1-yl)propan-2-one |
|---|---|
| PubChem CID | 147729484 |
| Molecular Formula | C19H24ClNO4S |
| Molecular Weight | 397.92 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 1-(4-chloro-2-hydroxy-3-pyrrolidin-1-ylsulfonylphenyl)-3-(2-methylcyclopent-2-en-1-yl)propan-2-one |
| SMILES | CC1=CCCC1CC(=O)Cc1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1O |
| InChI | InChI=1S/C19H24ClNO4S/c1-13-5-4-6-14(13)11-16(22)12-15-7-8-17(20)19(18(15)23)26(24,25)21-9-2-3-10-21/h5,7-8,14,23H,2-4,6,9-12H2,1H3 |
| InChIKey | GYDGUAMNQPYMFI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.92 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|