C7H7ClF3NS2 — CID 147744830
5-chloro-2-(3,4,4-trifluorobutylsulfanyl)-1,3-thiazole (PubChem CID 147744830) has the molecular formula C7H7ClF3NS2 and a molecular weight of 261.72 g/mol. Its IUPAC name is 5-chloro-2-(3,4,4-trifluorobutylsulfanyl)-1,3-thiazole.
| Compound Name | 5-chloro-2-(3,4,4-trifluorobutylsulfanyl)-1,3-thiazole |
|---|---|
| PubChem CID | 147744830 |
| Molecular Formula | C7H7ClF3NS2 |
| Molecular Weight | 261.72 g/mol |
| Exact Mass | 260.97 |
| IUPAC Name | 5-chloro-2-(3,4,4-trifluorobutylsulfanyl)-1,3-thiazole |
| SMILES | FC(F)C(F)CCSc1ncc(Cl)s1 |
| InChI | InChI=1S/C7H7ClF3NS2/c8-5-3-12-7(14-5)13-2-1-4(9)6(10)11/h3-4,6H,1-2H2 |
| InChIKey | HBBDNXWYBPKUED-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.72 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|