C3HClINS — CID 154533494
5-chloro-2-iodo-1,3-thiazole (PubChem CID 154533494) has the molecular formula C3HClINS and a molecular weight of 245.47 g/mol. Its IUPAC name is 5-chloro-2-iodo-1,3-thiazole.
| Compound Name | 5-chloro-2-iodo-1,3-thiazole |
|---|---|
| PubChem CID | 154533494 |
| Molecular Formula | C3HClINS |
| Molecular Weight | 245.47 g/mol |
| Exact Mass | 244.86 |
| IUPAC Name | 5-chloro-2-iodo-1,3-thiazole |
| SMILES | Clc1cnc(I)s1 |
| InChI | InChI=1S/C3HClINS/c4-2-1-6-3(5)7-2/h1H |
| InChIKey | NWWXGICORNVYSN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|