C4HClKNO2S — CID 170907506
potassium 5-chloro-1,3-thiazole-2-carboxylate (PubChem CID 170907506) has the molecular formula C4HClKNO2S and a molecular weight of 201.67 g/mol. Its IUPAC name is potassium 5-chloro-1,3-thiazole-2-carboxylate.
| Compound Name | potassium 5-chloro-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 170907506 |
| Molecular Formula | C4HClKNO2S |
| Molecular Weight | 201.67 g/mol |
| Exact Mass | 200.91 |
| IUPAC Name | potassium 5-chloro-1,3-thiazole-2-carboxylate |
| SMILES | O=C([O-])c1ncc(Cl)s1.[K+] |
| InChI | InChI=1S/C4H2ClNO2S.K/c5-2-1-6-3(9-2)4(7)8;/h1H,(H,7,8);/q;+1/p-1 |
| InChIKey | VVFNLLCRCDAWKF-UHFFFAOYSA-M |
| XLogP | -2.84 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.67 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |