C34H35I2O3P — CID 147748932
6-[2-butyl-6-[(3-butyl-5-iodo-2-methoxyphenyl)methyl]-4-iodophenoxy]benzo[c][2,1]benzoxaphosphinine (PubChem CID 147748932) has the molecular formula C34H35I2O3P and a molecular weight of 776.43 g/mol. Its IUPAC name is 6-[2-butyl-6-[(3-butyl-5-iodo-2-methoxyphenyl)methyl]-4-iodophenoxy]benzo[c][2,1]benzoxaphosphinine.
| Compound Name | 6-[2-butyl-6-[(3-butyl-5-iodo-2-methoxyphenyl)methyl]-4-iodophenoxy]benzo[c][2,1]benzoxaphosphinine |
|---|---|
| PubChem CID | 147748932 |
| Molecular Formula | C34H35I2O3P |
| Molecular Weight | 776.43 g/mol |
| Exact Mass | 776.04 |
| IUPAC Name | 6-[2-butyl-6-[(3-butyl-5-iodo-2-methoxyphenyl)methyl]-4-iodophenoxy]benzo[c][2,1]benzoxaphosphinine |
| SMILES | CCCCc1cc(I)cc(Cc2cc(I)cc(CCCC)c2OP2Oc3ccccc3-c3ccccc32)c1OC |
| InChI | InChI=1S/C34H35I2O3P/c1-4-6-12-23-19-27(35)21-25(33(23)37-3)18-26-22-28(36)20-24(13-7-5-2)34(26)39-40-32-17-11-9-15-30(32)29-14-8-10-16-31(29)38-40/h8-11,14-17,19-22H,4-7,12-13,18H2,1-3H3 |
| InChIKey | HBUWJUZIXSZEFR-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.43 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|