C20H25IO4 — CID 163664325
1-butyl-3-(3-iodo-2,5-dimethoxyphenyl)-2,5-dimethoxybenzene (PubChem CID 163664325) has the molecular formula C20H25IO4 and a molecular weight of 456.32 g/mol. Its IUPAC name is 1-butyl-3-(3-iodo-2,5-dimethoxyphenyl)-2,5-dimethoxybenzene.
| Compound Name | 1-butyl-3-(3-iodo-2,5-dimethoxyphenyl)-2,5-dimethoxybenzene |
|---|---|
| PubChem CID | 163664325 |
| Molecular Formula | C20H25IO4 |
| Molecular Weight | 456.32 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 1-butyl-3-(3-iodo-2,5-dimethoxyphenyl)-2,5-dimethoxybenzene |
| SMILES | CCCCc1cc(OC)cc(-c2cc(OC)cc(I)c2OC)c1OC |
| InChI | InChI=1S/C20H25IO4/c1-6-7-8-13-9-14(22-2)10-16(19(13)24-4)17-11-15(23-3)12-18(21)20(17)25-5/h9-12H,6-8H2,1-5H3 |
| InChIKey | IXBZQTAYWQWJLI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.32 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|