C19H23Cl2O4P — CID 126723131
[2-butyl-6-(2,5-dimethoxyphenyl)-4-methoxyphenoxy]-dichlorophosphane (PubChem CID 126723131) has the molecular formula C19H23Cl2O4P and a molecular weight of 417.27 g/mol. Its IUPAC name is [2-butyl-6-(2,5-dimethoxyphenyl)-4-methoxyphenoxy]-dichlorophosphane.
| Compound Name | [2-butyl-6-(2,5-dimethoxyphenyl)-4-methoxyphenoxy]-dichlorophosphane |
|---|---|
| PubChem CID | 126723131 |
| Molecular Formula | C19H23Cl2O4P |
| Molecular Weight | 417.27 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | [2-butyl-6-(2,5-dimethoxyphenyl)-4-methoxyphenoxy]-dichlorophosphane |
| SMILES | CCCCc1cc(OC)cc(-c2cc(OC)ccc2OC)c1OP(Cl)Cl |
| InChI | InChI=1S/C19H23Cl2O4P/c1-5-6-7-13-10-15(23-3)12-17(19(13)25-26(20)21)16-11-14(22-2)8-9-18(16)24-4/h8-12H,5-7H2,1-4H3 |
| InChIKey | MRQPAFVWIDOBGO-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.27 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|