C25H35N3O4 — CID 147779767
tert-butyl 3-[[5-[4-(cyclopropylmethoxy)butanoyl]-4-methylindazol-2-yl]methyl]azetidine-1-carboxylate (PubChem CID 147779767) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is tert-butyl 3-[[5-[4-(cyclopropylmethoxy)butanoyl]-4-methylindazol-2-yl]methyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[5-[4-(cyclopropylmethoxy)butanoyl]-4-methylindazol-2-yl]methyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 147779767 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | tert-butyl 3-[[5-[4-(cyclopropylmethoxy)butanoyl]-4-methylindazol-2-yl]methyl]azetidine-1-carboxylate |
| SMILES | Cc1c(C(=O)CCCOCC2CC2)ccc2nn(CC3CN(C(=O)OC(C)(C)C)C3)cc12 |
| InChI | InChI=1S/C25H35N3O4/c1-17-20(23(29)6-5-11-31-16-18-7-8-18)9-10-22-21(17)15-28(26-22)14-19-12-27(13-19)24(30)32-25(2,3)4/h9-10,15,18-19H,5-8,11-14,16H2,1-4H3 |
| InChIKey | HHODVONJXNRCQO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|