C20H24ClN5O — CID 147819731
9-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-7,9,10-triazatricyclo[5.3.0.02,10]deca-3,5-dien-8-one (PubChem CID 147819731) has the molecular formula C20H24ClN5O and a molecular weight of 385.90 g/mol. Its IUPAC name is 9-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-7,9,10-triazatricyclo[5.3.0.02,10]deca-3,5-dien-8-one.
| Compound Name | 9-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-7,9,10-triazatricyclo[5.3.0.02,10]deca-3,5-dien-8-one |
|---|---|
| PubChem CID | 147819731 |
| Molecular Formula | C20H24ClN5O |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 9-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-7,9,10-triazatricyclo[5.3.0.02,10]deca-3,5-dien-8-one |
| SMILES | O=C1N2C=CC=CC3C2N3N1CCCN1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C20H24ClN5O/c21-16-5-3-6-17(15-16)23-13-11-22(12-14-23)8-4-10-25-20(27)24-9-2-1-7-18-19(24)26(18)25/h1-3,5-7,9,15,18-19H,4,8,10-14H2 |
| InChIKey | HOZRWHWLRISKOO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 33.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|