C26H25N5O13S4 — CID 147848492
[4-[[4-[[6-amino-1-hydroxy-5-methoxysulfonyl-3-(sulfomethyl)naphthalen-2-yl]diazenyl]-3-methoxysulfonylphenyl]diazenyl]phenyl]methanesulfonic acid (PubChem CID 147848492) has the molecular formula C26H25N5O13S4 and a molecular weight of 743.78 g/mol. Its IUPAC name is [4-[[4-[[6-amino-1-hydroxy-5-methoxysulfonyl-3-(sulfomethyl)naphthalen-2-yl]diazenyl]-3-methoxysulfonylphenyl]diazenyl]phenyl]methanesulfonic acid.
| Compound Name | [4-[[4-[[6-amino-1-hydroxy-5-methoxysulfonyl-3-(sulfomethyl)naphthalen-2-yl]diazenyl]-3-methoxysulfonylphenyl]diazenyl]phenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 147848492 |
| Molecular Formula | C26H25N5O13S4 |
| Molecular Weight | 743.78 g/mol |
| Exact Mass | 743.03 |
| IUPAC Name | [4-[[4-[[6-amino-1-hydroxy-5-methoxysulfonyl-3-(sulfomethyl)naphthalen-2-yl]diazenyl]-3-methoxysulfonylphenyl]diazenyl]phenyl]methanesulfonic acid |
| SMILES | COS(=O)(=O)c1cc(/N=N/c2ccc(CS(=O)(=O)O)cc2)ccc1/N=N/c1c(CS(=O)(=O)O)cc2c(S(=O)(=O)OC)c(N)ccc2c1O |
| InChI | InChI=1S/C26H25N5O13S4/c1-43-47(39,40)23-12-18(29-28-17-5-3-15(4-6-17)13-45(33,34)35)7-10-22(23)30-31-24-16(14-46(36,37)38)11-20-19(25(24)32)8-9-21(27)26(20)48(41,42)44-2/h3-12,32H,13-14,27H2,1-2H3,(H,33,34,35)(H,36,37,38)/b29-28+,31-30+ |
| InChIKey | HUIYSYMMEBJELU-DUJDKOHPSA-N |
| XLogP | 4.40 |
| TPSA | 291.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.78 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|