C30H27N5O4S — CID 159186272
methyl 7-(ethylamino)-4-hydroxy-3-[[3-methyl-4-(naphthalen-1-yldiazenyl)phenyl]diazenyl]naphthalene-2-sulfonate (PubChem CID 159186272) has the molecular formula C30H27N5O4S and a molecular weight of 553.64 g/mol. Its IUPAC name is methyl 7-(ethylamino)-4-hydroxy-3-[[3-methyl-4-(naphthalen-1-yldiazenyl)phenyl]diazenyl]naphthalene-2-sulfonate.
| Compound Name | methyl 7-(ethylamino)-4-hydroxy-3-[[3-methyl-4-(naphthalen-1-yldiazenyl)phenyl]diazenyl]naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 159186272 |
| Molecular Formula | C30H27N5O4S |
| Molecular Weight | 553.64 g/mol |
| Exact Mass | 553.18 |
| IUPAC Name | methyl 7-(ethylamino)-4-hydroxy-3-[[3-methyl-4-(naphthalen-1-yldiazenyl)phenyl]diazenyl]naphthalene-2-sulfonate |
| SMILES | CCNc1ccc2c(O)c(/N=N/c3ccc(/N=N/c4cccc5ccccc45)c(C)c3)c(S(=O)(=O)OC)cc2c1 |
| InChI | InChI=1S/C30H27N5O4S/c1-4-31-22-12-14-25-21(17-22)18-28(40(37,38)39-3)29(30(25)36)35-32-23-13-15-26(19(2)16-23)33-34-27-11-7-9-20-8-5-6-10-24(20)27/h5-18,31,36H,4H2,1-3H3/b34-33+,35-32+ |
| InChIKey | HQVDUXPSZLRHPB-LQTIRQTFSA-N |
| XLogP | 8.60 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.64 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|