C34H33O5P — CID 14787685
3,3,3-tris(2,6-dimethylphenoxy)-2,4-dioxa-3lambda5-phosphatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene (PubChem CID 14787685) has the molecular formula C34H33O5P and a molecular weight of 552.61 g/mol. Its IUPAC name is 3,3,3-tris(2,6-dimethylphenoxy)-2,4-dioxa-3lambda5-phosphatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene.
| Compound Name | 3,3,3-tris(2,6-dimethylphenoxy)-2,4-dioxa-3lambda5-phosphatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
|---|---|
| PubChem CID | 14787685 |
| Molecular Formula | C34H33O5P |
| Molecular Weight | 552.61 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | 3,3,3-tris(2,6-dimethylphenoxy)-2,4-dioxa-3lambda5-phosphatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
| SMILES | Cc1cccc(C)c1OP1(Oc2c(C)cccc2C)(Oc2c(C)cccc2C)Oc2cccc3cccc(c23)O1 |
| InChI | InChI=1S/C34H33O5P/c1-22-12-7-13-23(2)32(22)37-40(38-33-24(3)14-8-15-25(33)4,39-34-26(5)16-9-17-27(34)6)35-29-20-10-18-28-19-11-21-30(36-40)31(28)29/h7-21H,1-6H3 |
| InChIKey | XUDJCFWCRCPRRM-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.61 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|