C14H15O2P — CID 137456680
3-tert-butyl-2,4-dioxa-3-phosphatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene (PubChem CID 137456680) has the molecular formula C14H15O2P and a molecular weight of 246.25 g/mol. Its IUPAC name is 3-tert-butyl-2,4-dioxa-3-phosphatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene.
| Compound Name | 3-tert-butyl-2,4-dioxa-3-phosphatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
|---|---|
| PubChem CID | 137456680 |
| Molecular Formula | C14H15O2P |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 3-tert-butyl-2,4-dioxa-3-phosphatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
| SMILES | CC(C)(C)P1Oc2cccc3cccc(c23)O1 |
| InChI | InChI=1S/C14H15O2P/c1-14(2,3)17-15-11-8-4-6-10-7-5-9-12(16-17)13(10)11/h4-9H,1-3H3 |
| InChIKey | SKUSTFMSSXZWTO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|