C10H6BIO2 — CID 147759134
3-iodo-2,4-dioxa-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene (PubChem CID 147759134) has the molecular formula C10H6BIO2 and a molecular weight of 295.87 g/mol. Its IUPAC name is 3-iodo-2,4-dioxa-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene.
| Compound Name | 3-iodo-2,4-dioxa-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
|---|---|
| PubChem CID | 147759134 |
| Molecular Formula | C10H6BIO2 |
| Molecular Weight | 295.87 g/mol |
| Exact Mass | 295.95 |
| IUPAC Name | 3-iodo-2,4-dioxa-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
| SMILES | IB1Oc2cccc3cccc(c23)O1 |
| InChI | InChI=1S/C10H6BIO2/c12-11-13-8-5-1-3-7-4-2-6-9(14-11)10(7)8/h1-6H |
| InChIKey | HDSGTAYJKCXRTH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.87 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|