C13H10O2S — CID 56613040
3-methylsulfanyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5,7,9(13),10-hexaen-4-ol (PubChem CID 56613040) has the molecular formula C13H10O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is 3-methylsulfanyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5,7,9(13),10-hexaen-4-ol.
| Compound Name | 3-methylsulfanyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5,7,9(13),10-hexaen-4-ol |
|---|---|
| PubChem CID | 56613040 |
| Molecular Formula | C13H10O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 3-methylsulfanyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5,7,9(13),10-hexaen-4-ol |
| SMILES | CSC1=C(O)c2cccc3cccc(c23)O1 |
| InChI | InChI=1S/C13H10O2S/c1-16-13-12(14)9-6-2-4-8-5-3-7-10(15-13)11(8)9/h2-7,14H,1H3 |
| InChIKey | KTFDNEFZOZWJBZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |