C16H17NO3 — CID 147949159
[4-(methylamino)phenyl] 4-acetylcyclohexa-1,3-diene-1-carboxylate (PubChem CID 147949159) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is [4-(methylamino)phenyl] 4-acetylcyclohexa-1,3-diene-1-carboxylate.
| Compound Name | [4-(methylamino)phenyl] 4-acetylcyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 147949159 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | [4-(methylamino)phenyl] 4-acetylcyclohexa-1,3-diene-1-carboxylate |
| SMILES | CNc1ccc(OC(=O)C2=CC=C(C(C)=O)CC2)cc1 |
| InChI | InChI=1S/C16H17NO3/c1-11(18)12-3-5-13(6-4-12)16(19)20-15-9-7-14(17-2)8-10-15/h3,5,7-10,17H,4,6H2,1-2H3 |
| InChIKey | INGPNYVFOBYJJN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|