C14H16ClN — CID 147951634
(4-chlorocyclohexa-2,4-dien-1-yl)-(4-methylcyclohexa-1,3-dien-1-yl)methanimine (PubChem CID 147951634) has the molecular formula C14H16ClN and a molecular weight of 233.74 g/mol. Its IUPAC name is (4-chlorocyclohexa-2,4-dien-1-yl)-(4-methylcyclohexa-1,3-dien-1-yl)methanimine.
| Compound Name | (4-chlorocyclohexa-2,4-dien-1-yl)-(4-methylcyclohexa-1,3-dien-1-yl)methanimine |
|---|---|
| PubChem CID | 147951634 |
| Molecular Formula | C14H16ClN |
| Molecular Weight | 233.74 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | (4-chlorocyclohexa-2,4-dien-1-yl)-(4-methylcyclohexa-1,3-dien-1-yl)methanimine |
| SMILES | [H]/N=C(\C1=CC=C(C)CC1)C1C=CC(Cl)=CC1 |
| InChI | InChI=1S/C14H16ClN/c1-10-2-4-11(5-3-10)14(16)12-6-8-13(15)9-7-12/h2,4,6,8-9,12,16H,3,5,7H2,1H3/b16-14+ |
| InChIKey | IGFWUYCPKCJPMG-JQIJEIRASA-N |
| XLogP | 4.37 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.74 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|