C24H36O13 — CID 14805569
[(2R,3S,4R,6R)-3,4-diacetyloxy-6-[[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methoxy]oxan-2-yl]methyl acetate (PubChem CID 14805569) has the molecular formula C24H36O13 and a molecular weight of 532.54 g/mol. Its IUPAC name is [(2R,3S,4R,6R)-3,4-diacetyloxy-6-[[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,6R)-3,4-diacetyloxy-6-[[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 14805569 |
| Molecular Formula | C24H36O13 |
| Molecular Weight | 532.54 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | [(2R,3S,4R,6R)-3,4-diacetyloxy-6-[[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC[C@@]23OC[C@H]4OC(C)(C)O[C@H]4[C@@H]2OC(C)(C)O3)C[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H36O13/c1-12(25)28-9-16-19(32-14(3)27)15(31-13(2)26)8-18(33-16)29-11-24-21(36-23(6,7)37-24)20-17(10-30-24)34-22(4,5)35-20/h15-21H,8-11H2,1-7H3/t15-,16-,17-,18-,19+,20-,21+,24+/m1/s1 |
| InChIKey | BOBHAUFUUCHMID-PKZRQCBXSA-N |
| XLogP | 0.94 |
| TPSA | 143.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.54 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|