C17H20O4 — CID 14807189
(2S,6S)-2-(1-ethoxyethoxy)-6-[(E)-2-phenylethenyl]-2H-pyran-5-one (PubChem CID 14807189) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is (2S,6S)-2-(1-ethoxyethoxy)-6-[(E)-2-phenylethenyl]-2H-pyran-5-one.
| Compound Name | (2S,6S)-2-(1-ethoxyethoxy)-6-[(E)-2-phenylethenyl]-2H-pyran-5-one |
|---|---|
| PubChem CID | 14807189 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (2S,6S)-2-(1-ethoxyethoxy)-6-[(E)-2-phenylethenyl]-2H-pyran-5-one |
| SMILES | CCOC(C)O[C@H]1C=CC(=O)[C@H](/C=C/c2ccccc2)O1 |
| InChI | InChI=1S/C17H20O4/c1-3-19-13(2)20-17-12-10-15(18)16(21-17)11-9-14-7-5-4-6-8-14/h4-13,16-17H,3H2,1-2H3/b11-9+/t13?,16-,17+/m0/s1 |
| InChIKey | HZEZAAUFHJKCNE-KMDUORPMSA-N |
| XLogP | 2.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|