C15H23NO2 — CID 14822623
N-(2,3-dihydro-1H-inden-1-ylmethyl)-2,2-dimethoxy-N-methylethanamine (PubChem CID 14822623) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-1-ylmethyl)-2,2-dimethoxy-N-methylethanamine.
| Compound Name | N-(2,3-dihydro-1H-inden-1-ylmethyl)-2,2-dimethoxy-N-methylethanamine |
|---|---|
| PubChem CID | 14822623 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-1-ylmethyl)-2,2-dimethoxy-N-methylethanamine |
| SMILES | COC(CN(C)CC1CCc2ccccc21)OC |
| InChI | InChI=1S/C15H23NO2/c1-16(11-15(17-2)18-3)10-13-9-8-12-6-4-5-7-14(12)13/h4-7,13,15H,8-11H2,1-3H3 |
| InChIKey | FTBOHCSCGUAYHL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|