C28H34O2Si — CID 14843640
(2S,3R)-2-ethyl-2-methyl-3-triphenylsilyloxyheptanal (PubChem CID 14843640) has the molecular formula C28H34O2Si and a molecular weight of 430.66 g/mol. Its IUPAC name is (2S,3R)-2-ethyl-2-methyl-3-triphenylsilyloxyheptanal.
| Compound Name | (2S,3R)-2-ethyl-2-methyl-3-triphenylsilyloxyheptanal |
|---|---|
| PubChem CID | 14843640 |
| Molecular Formula | C28H34O2Si |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | (2S,3R)-2-ethyl-2-methyl-3-triphenylsilyloxyheptanal |
| SMILES | CCCC[C@@H](O[Si](c1ccccc1)(c1ccccc1)c1ccccc1)[C@@](C)(C=O)CC |
| InChI | InChI=1S/C28H34O2Si/c1-4-6-22-27(28(3,5-2)23-29)30-31(24-16-10-7-11-17-24,25-18-12-8-13-19-25)26-20-14-9-15-21-26/h7-21,23,27H,4-6,22H2,1-3H3/t27-,28-/m1/s1 |
| InChIKey | XYTXYSJUMJUVLF-VSGBNLITSA-N |
| XLogP | 4.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|