C15H21N6O4+ — CID 148537565
2-(2,4-diaminopyrrolo[2,1-f][1,2,4]triazin-3-ium-7-yl)-3,4-dihydroxy-5-(propan-2-yloxymethyl)oxolane-2-carbonitrile (PubChem CID 148537565) has the molecular formula C15H21N6O4+ and a molecular weight of 349.37 g/mol. Its IUPAC name is 2-(2,4-diaminopyrrolo[2,1-f][1,2,4]triazin-3-ium-7-yl)-3,4-dihydroxy-5-(propan-2-yloxymethyl)oxolane-2-carbonitrile.
| Compound Name | 2-(2,4-diaminopyrrolo[2,1-f][1,2,4]triazin-3-ium-7-yl)-3,4-dihydroxy-5-(propan-2-yloxymethyl)oxolane-2-carbonitrile |
|---|---|
| PubChem CID | 148537565 |
| Molecular Formula | C15H21N6O4+ |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 2-(2,4-diaminopyrrolo[2,1-f][1,2,4]triazin-3-ium-7-yl)-3,4-dihydroxy-5-(propan-2-yloxymethyl)oxolane-2-carbonitrile |
| SMILES | CC(C)OCC1OC(C#N)(c2ccc3c(N)[nH+]c(N)nn23)C(O)C1O |
| InChI | InChI=1S/C15H20N6O4/c1-7(2)24-5-9-11(22)12(23)15(6-16,25-9)10-4-3-8-13(17)19-14(18)20-21(8)10/h3-4,7,9,11-12,22-23H,5H2,1-2H3,(H4,17,18,19,20)/p+1 |
| InChIKey | MRNHBPMBQFWTEE-UHFFFAOYSA-O |
| XLogP | -1.42 |
| TPSA | 166.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |