C15H20N6O4 — CID 78046704
2-(2,4-diaminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-(propan-2-yloxymethyl)oxolane-2-carbonitrile (PubChem CID 78046704) has the molecular formula C15H20N6O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is 2-(2,4-diaminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-(propan-2-yloxymethyl)oxolane-2-carbonitrile.
| Compound Name | 2-(2,4-diaminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-(propan-2-yloxymethyl)oxolane-2-carbonitrile |
|---|---|
| PubChem CID | 78046704 |
| Molecular Formula | C15H20N6O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2-(2,4-diaminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-(propan-2-yloxymethyl)oxolane-2-carbonitrile |
| SMILES | CC(C)OCC1OC(C#N)(c2ccc3c(N)nc(N)nn23)C(O)C1O |
| InChI | InChI=1S/C15H20N6O4/c1-7(2)24-5-9-11(22)12(23)15(6-16,25-9)10-4-3-8-13(17)19-14(18)20-21(8)10/h3-4,7,9,11-12,22-23H,5H2,1-2H3,(H4,17,18,19,20) |
| InChIKey | MRNHBPMBQFWTEE-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 164.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |