C7H14F3N5O — CID 148541758
N-[amino-[amino(2-methoxyethyl)amino]methylidene]-2,2,2-trifluoro-N'-methylethanimidamide (PubChem CID 148541758) has the molecular formula C7H14F3N5O and a molecular weight of 241.22 g/mol. Its IUPAC name is N-[amino-[amino(2-methoxyethyl)amino]methylidene]-2,2,2-trifluoro-N'-methylethanimidamide.
| Compound Name | N-[amino-[amino(2-methoxyethyl)amino]methylidene]-2,2,2-trifluoro-N'-methylethanimidamide |
|---|---|
| PubChem CID | 148541758 |
| Molecular Formula | C7H14F3N5O |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | N-[amino-[amino(2-methoxyethyl)amino]methylidene]-2,2,2-trifluoro-N'-methylethanimidamide |
| SMILES | C/N=C(/N=C(\N)N(N)CCOC)C(F)(F)F |
| InChI | InChI=1S/C7H14F3N5O/c1-13-5(7(8,9)10)14-6(11)15(12)3-4-16-2/h3-4,12H2,1-2H3,(H2,11,13,14) |
| InChIKey | MSHMEAGXTSHQEJ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|