C11H25N3O2 — CID 62364543
2-tert-butyl-1,1-bis(2-methoxyethyl)guanidine (PubChem CID 62364543) has the molecular formula C11H25N3O2 and a molecular weight of 231.34 g/mol. Its IUPAC name is 2-tert-butyl-1,1-bis(2-methoxyethyl)guanidine.
| Compound Name | 2-tert-butyl-1,1-bis(2-methoxyethyl)guanidine |
|---|---|
| PubChem CID | 62364543 |
| Molecular Formula | C11H25N3O2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.19 |
| IUPAC Name | 2-tert-butyl-1,1-bis(2-methoxyethyl)guanidine |
| SMILES | COCCN(CCOC)/C(N)=N/C(C)(C)C |
| InChI | InChI=1S/C11H25N3O2/c1-11(2,3)13-10(12)14(6-8-15-4)7-9-16-5/h6-9H2,1-5H3,(H2,12,13) |
| InChIKey | XRGJPHLFPRHJCA-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|