C17H18N2 — CID 148547444
1,2,3,4,4a,5-hexahydroisoquinolino[3,2-c][1,4]benzodiazepine (PubChem CID 148547444) has the molecular formula C17H18N2 and a molecular weight of 250.35 g/mol. Its IUPAC name is 1,2,3,4,4a,5-hexahydroisoquinolino[3,2-c][1,4]benzodiazepine.
| Compound Name | 1,2,3,4,4a,5-hexahydroisoquinolino[3,2-c][1,4]benzodiazepine |
|---|---|
| PubChem CID | 148547444 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1,2,3,4,4a,5-hexahydroisoquinolino[3,2-c][1,4]benzodiazepine |
| SMILES | C1=C2CCCCC2NC=C2C=c3ccccc3=CN12 |
| InChI | InChI=1S/C17H18N2/c1-2-6-14-11-19-12-15-7-3-4-8-17(15)18-10-16(19)9-13(14)5-1/h1-2,5-6,9-12,17-18H,3-4,7-8H2 |
| InChIKey | MQKPZQVMDPMZDF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |