C12H14N2 — CID 87297165
1,2,3,4,4a,5-hexahydrobenzo[c][1,6]naphthyridine (PubChem CID 87297165) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 1,2,3,4,4a,5-hexahydrobenzo[c][1,6]naphthyridine.
| Compound Name | 1,2,3,4,4a,5-hexahydrobenzo[c][1,6]naphthyridine |
|---|---|
| PubChem CID | 87297165 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 1,2,3,4,4a,5-hexahydrobenzo[c][1,6]naphthyridine |
| SMILES | C1=c2ccccc2=C2CNCCC2N1 |
| InChI | InChI=1S/C12H14N2/c1-2-4-10-9(3-1)7-14-12-5-6-13-8-11(10)12/h1-4,7,12-14H,5-6,8H2 |
| InChIKey | NKNWEIHLPISMCS-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |