C12H12N2O — CID 87803600
3,4,4a,5-tetrahydro-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 87803600) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is 3,4,4a,5-tetrahydro-2H-benzo[c][1,6]naphthyridin-1-one.
| Compound Name | 3,4,4a,5-tetrahydro-2H-benzo[c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 87803600 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 3,4,4a,5-tetrahydro-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | O=C1NCCC2NC=c3ccccc3=C12 |
| InChI | InChI=1S/C12H12N2O/c15-12-11-9-4-2-1-3-8(9)7-14-10(11)5-6-13-12/h1-4,7,10,14H,5-6H2,(H,13,15) |
| InChIKey | FRCNZAUNTHTPQI-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |