C24H28N4O5 — CID 14855119
[(2S)-1-[benzyl(methyl)amino]propan-2-yl] 2-methoxy-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 14855119) has the molecular formula C24H28N4O5 and a molecular weight of 452.51 g/mol. Its IUPAC name is [(2S)-1-[benzyl(methyl)amino]propan-2-yl] 2-methoxy-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | [(2S)-1-[benzyl(methyl)amino]propan-2-yl] 2-methoxy-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 14855119 |
| Molecular Formula | C24H28N4O5 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | [(2S)-1-[benzyl(methyl)amino]propan-2-yl] 2-methoxy-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | COC1=NC(c2cccc([N+](=O)[O-])c2)C(C(=O)O[C@@H](C)CN(C)Cc2ccccc2)=C(C)N1 |
| InChI | InChI=1S/C24H28N4O5/c1-16(14-27(3)15-18-9-6-5-7-10-18)33-23(29)21-17(2)25-24(32-4)26-22(21)19-11-8-12-20(13-19)28(30)31/h5-13,16,22H,14-15H2,1-4H3,(H,25,26)/t16-,22?/m0/s1 |
| InChIKey | IGUVOXUHZVTEFH-CISYCMJJSA-N |
| XLogP | 3.58 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|