C18H19N5O3S — CID 148591592
5-(3-ethyl-1-ethylsulfonylazetidin-3-yl)-4,5,10,12-tetrazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2(6),3,8,10,13-hexaen-7-one (PubChem CID 148591592) has the molecular formula C18H19N5O3S and a molecular weight of 385.45 g/mol. Its IUPAC name is 5-(3-ethyl-1-ethylsulfonylazetidin-3-yl)-4,5,10,12-tetrazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2(6),3,8,10,13-hexaen-7-one.
| Compound Name | 5-(3-ethyl-1-ethylsulfonylazetidin-3-yl)-4,5,10,12-tetrazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2(6),3,8,10,13-hexaen-7-one |
|---|---|
| PubChem CID | 148591592 |
| Molecular Formula | C18H19N5O3S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 5-(3-ethyl-1-ethylsulfonylazetidin-3-yl)-4,5,10,12-tetrazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2(6),3,8,10,13-hexaen-7-one |
| SMILES | CCC1(n2ncc3c4cc[nH]c5ncc(c(=O)c32)c54)CN(S(=O)(=O)CC)C1 |
| InChI | InChI=1S/C18H19N5O3S/c1-3-18(9-22(10-18)27(25,26)4-2)23-15-12(8-21-23)11-5-6-19-17-14(11)13(7-20-17)16(15)24/h5-8H,3-4,9-10H2,1-2H3,(H,19,20) |
| InChIKey | NATBGLGOGQKENE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 100.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |