C25H23F3N2O4 — CID 148612440
1-[6-(2,6-difluorophenyl)-5-fluoro-2-pyridinyl]-2-[4-[(2S,3R,4S,5R,6S)-4,5-dihydroxy-3,6-dimethyloxan-2-yl]-3-pyridinyl]ethanone (PubChem CID 148612440) has the molecular formula C25H23F3N2O4 and a molecular weight of 472.46 g/mol. Its IUPAC name is 1-[6-(2,6-difluorophenyl)-5-fluoro-2-pyridinyl]-2-[4-[(2S,3R,4S,5R,6S)-4,5-dihydroxy-3,6-dimethyloxan-2-yl]-3-pyridinyl]ethanone.
| Compound Name | 1-[6-(2,6-difluorophenyl)-5-fluoro-2-pyridinyl]-2-[4-[(2S,3R,4S,5R,6S)-4,5-dihydroxy-3,6-dimethyloxan-2-yl]-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 148612440 |
| Molecular Formula | C25H23F3N2O4 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 1-[6-(2,6-difluorophenyl)-5-fluoro-2-pyridinyl]-2-[4-[(2S,3R,4S,5R,6S)-4,5-dihydroxy-3,6-dimethyloxan-2-yl]-3-pyridinyl]ethanone |
| SMILES | CC1[C@@H](c2ccncc2CC(=O)c2ccc(F)c(-c3c(F)cccc3F)n2)O[C@@H](C)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H23F3N2O4/c1-12-23(32)24(33)13(2)34-25(12)15-8-9-29-11-14(15)10-20(31)19-7-6-18(28)22(30-19)21-16(26)4-3-5-17(21)27/h3-9,11-13,23-25,32-33H,10H2,1-2H3/t12?,13-,23-,24-,25-/m0/s1 |
| InChIKey | NEQKCJCULUSGOD-OLRKDTEQSA-N |
| XLogP | 3.80 |
| TPSA | 92.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |